S151478
4-(3-Methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid , ≥98% , 60875-16-3
CAS NO.:60875-16-3
Empirical Formula: C11H10N2O3
Molecular Weight: 218.21
MDL number: MFCD00003135
EINECS: 262-509-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB667.26 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 285 °C (dec.) (lit.) |
| Boiling point: | 358.89°C (rough estimate) |
| Density | 1.2699 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| form | Solid |
| pka | 4.31±0.10(Predicted) |
| color | Pale Yellow to Yellow |
| InChI | 1S/C11H10N2O3/c1-7-6-10(14)13(12-7)9-4-2-8(3-5-9)11(15)16/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | CUGBBQWDGCXWNB-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1)c2ccc(cc2)C(O)=O |
| CAS DataBase Reference | 60875-16-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 4-(4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl)- (60875-16-3) |
Description and Uses
1-(4-Carboxyphenyl)-3-methyl-5-pyrazolone can be used to modulate p300/cbp activity.





