S179379
(?)-Isolongifolene , ≥98.0%(sumofenantiomers,GC) , 1135-66-6
Synonym(s):
(1R)-2,2,7,7-Tetramethyltricyclo[6.2.1.01.6]undec-5-ene
CAS NO.:1135-66-6
Empirical Formula: C15H24
Molecular Weight: 204.35
MDL number: MFCD00042616
EINECS: 214-494-2
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB1655.44 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 255-256 °C |
| Density | 0.930 g/mL at 20 °C(lit.) |
| vapor pressure | 5.49Pa at 25℃ |
| refractive index | n |
| Flash point: | 49°C |
| storage temp. | 2-8°C |
| solubility | DMSO: 10 mg/mL (48.94 mM) |
| form | Liquid |
| color | Colorless to light yellow |
| Odor | at 100.00 %. woody dusty amber incense |
| Odor Type | woody |
| optical activity | [α]20/D 138±2°, c = 1% in ethanol |
| Water Solubility | 59.998μg/L at 25℃ |
| BRN | 2207559 |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C15H24/c1-13(2)8-5-6-12-14(3,4)11-7-9-15(12,13)10-11/h6,11H,5,7-10H2,1-4H3/t11-,15-/m0/s1 |
| InChIKey | CQUAYTJDLQBXCQ-NHYWBVRUSA-N |
| SMILES | CC1(C)CCC=C2C(C)(C)[C@H]3CC[C@@]12C3 |
| LogP | 5.77 at 25℃ |
| CAS DataBase Reference | 1135-66-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2H-2,4a-methanonaphthalene, 1,3,4,5,6,7-hexahydro-1,1,5,5-tetramethyl-, (2s)-(1135-66-6) |
| EPA Substance Registry System | 2H-2,4a-Methanonaphthalene, 1,3,4,5,6,7-hexahydro-1,1,5,5-tetramethyl-, (2S,4aR)- (1135-66-6) |
Description and Uses
(-)-Isolongifolene may be used in the preparation of (-)-isolongifolenone, a potent insect repellent.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Risk Statements | 10 |
| RIDADR | UN 2319 3/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |




