S1835249
analyticalstandard , 23452-05-3
Synonym(s):
3,7-Dihydroxy-9-methoxy-1-methyl-6H-dibenzo[b,d]pyran-6-one;Alternariol monomethyl ether
| Pack Size | Price | Stock | Quantity |
| 100μG | RMB10124.47 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 277-279 °C |
| Boiling point: | 335.31°C (rough estimate) |
| Density | 1.2066 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | -20°C |
| solubility | Dichloromethane: soluble; Methanol: soluble |
| form | Solid |
| pka | 7.00±0.20(Predicted) |
| color | Off-white to light yellow |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C15H12O5/c1-7-3-8(16)4-12-13(7)10-5-9(19-2)6-11(17)14(10)15(18)20-12/h3-6,16-17H,1-2H3 |
| InChIKey | LCSDQFNUYFTXMT-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2C(=O)Oc3cc(O)cc(C)c3-c2c1 |
Description and Uses
Alternariol Monomethyl Ether is a mycotoxins found in subsistence farmed maize. Also, it is a natural mycotoxin isolated from the fermentation broth of Trichoderma sp. Jing-8 with phytotoxic, antibacterial and antioxidant activities. Also, it is derived from 3,5-Dimethoxyiodobenzene (D460640), which is an intermediate for the synthesis of glucuronide conjugates of trans-Resveratrol.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P280-P301+P312+P330-P302+P352 |
| Hazard Codes | Xn |
| Risk Statements | 22-43 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
