PRODUCT Properties
| Melting point: | 104°C (lit.) |
| form | solid |
| InChI | 1S/C8H19NO5/c10-3-1-9(2-4-11)8(5-12,6-13)7-14/h10-14H,1-7H2/i1D2,2D2,3D2,4D2,5D2,6D2,7D2,10D,11D,12D,13D,14D |
| InChIKey | OWMVSZAMULFTJU-ZMHMTVDGSA-N |
| SMILES | [2H]OC([2H])([2H])C([2H])([2H])N(C([2H])([2H])C([2H])([2H])O[2H])C(C([2H])([2H])O[2H])(C([2H])([2H])O[2H])C([2H])([2H])O[2H] |
| CAS Number Unlabeled | 6976-37-0 |
Description and Uses
Bis-Tris-d19 is the deuterium labeled Bis-Tris[1]. Bis-Tris is a commonly used buffer[2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |





