S197578
1.0 MinTHF , 67276-04-4
Synonym(s):
Sodium tri-sec-butylborohydride solution
CAS NO.：67276-04-4
Empirical Formula: C12H28BNa
Molecular Weight: 206.15
MDL number: MFCD00011709
EINECS: 266-630-5
| Pack Size | Price | Stock | Quantity |
| 100ml | RMB860.38 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 0.893 g/mL at 25 °C(lit.) |
| Flash point: | 5 °F |
| storage temp. | Flammables + water-Freezer (-20°C)e area |
| form | liquid |
| InChI | 1S/C12H28B.Na/c1-7-10(4)13(11(5)8-2)12(6)9-3;/h10-13H,7-9H2,1-6H3;/q-1;+1 |
| InChIKey | JUFGMKFPFVIKOY-UHFFFAOYSA-N |
| SMILES | [Na+].CCC(C)[BH-](C(C)CC)C(C)CC |
Description and Uses
- Reducing agent
Reactant for:
- Conjugate hydride reduction-initiated tandem cyclization reactions
- Sereoselective nucleophilic addition reactions
Safety
| Symbol(GHS) |     GHS02,GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H260-H302-H314-H335-H351 |
| Precautionary statements | P210-P231+P232-P280-P370+P378-P402+P404-P403+P235 |
| target organs | Respiratory system |
| Hazard Codes | F,C |
| Risk Statements | 11-14/15-19-22-34-37-40 |
| Safety Statements | 16-26-27-36/37/39-45-43 |
| RIDADR | UN 3399 4.3/PG 1 |
| WGK Germany | 1 |
| HS Code | 29319090 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Flam. Liq. 2 Skin Corr. 1B STOT SE 3 Water-react 1 |
