S2026116
cis-3-Hexenyl crotonate , ≥97% , 65405-80-3
CAS NO.:65405-80-3
Empirical Formula: C10H16O2
Molecular Weight: 168.23
MDL number: MFCD00059903
EINECS: 265-746-3
| Pack Size | Price | Stock | Quantity |
| sample | RMB507.18 | In Stock |
|
| 1SAMPLE | RMB507.18 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 107 °C25 mm Hg(lit.) |
| Density | 0.91 g/mL at 25 °C(lit.) |
| FEMA | 3982 | (Z)-3-HEXENYL (E)-2-BUTENOATE |
| refractive index | n |
| Flash point: | 202 °F |
| Odor | at 100.00 %. green vegetable |
| Odor Type | green |
| biological source | synthetic |
| JECFA Number | 1276 |
| Major Application | flavors and fragrances |
| InChI | 1S/C10H16O2/c1-3-5-6-7-9-12-10(11)8-4-2/h4-6,8H,3,7,9H2,1-2H3/b6-5-,8-4+ |
| InChIKey | KITGYVIOYOCIIE-QNMAEOQASA-N |
| SMILES | [H]\C(C)=C(\[H])C(=O)OCC\C([H])=C(\[H])CC |
| LogP | 3.65 |
| CAS DataBase Reference | 65405-80-3 |
| EPA Substance Registry System | 2-Butenoic acid, (3Z)-3-hexenyl ester, (2E)- (65405-80-3) |
Description and Uses
flavors and fragrances
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |






