PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 467.79°C (rough estimate) |
| Density | 1.1843 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| pka | 14.19±0.10(Predicted) |
| Colour Index | 11130 |
| form | Crystalline Powder |
| color | Dark purple to dark red-brown |
| Water Solubility | 234.5ug/L(25 ºC) |
| λmax | 495 nm |
| InChI | 1S/C16H18N4O4/c21-11-9-19(10-12-22)15-5-1-13(2-6-15)17-18-14-3-7-16(8-4-14)20(23)24/h1-8,21-22H,9-12H2/b18-17+ |
| InChIKey | GHDZRIQTRDZCMV-ISLYRVAYSA-N |
| SMILES | OCCN(CCO)c1ccc(cc1)\N=N\c2ccc(cc2)[N+]([O-])=O |
| EPA Substance Registry System | C.I. Disperse Red 19 (2734-52-3) |
Description and Uses
DR19 can be used as red side groups in an NLO polyester for potential application in optical switching devices. It can also be bonded with polyurethane to form stable films, which may be used in the fabrication of analog systems.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P280-P301+P312+P330-P302+P352 |
| Hazard Codes | Xn |
| Risk Statements | 22-43 |
| Safety Statements | 24/25-36/37 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |





