S2050149
UnitedStatesPharmacopeia(USP)ReferenceStandard , 76-75-5
Synonym(s):
(±)-Thiopental;5-Ethyl-5-(1-methylbutyl)-2-thiobarbituric acid;Pentothal
CAS NO.:76-75-5
Empirical Formula: C11H18N2O2S
Molecular Weight: 242.34
MDL number: MFCD00057564
EINECS: 200-984-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB4132.10 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-160°C |
| Density | 1.1789 (rough estimate) |
| refractive index | 1.5440 (estimate) |
| Flash point: | 11℃ |
| storage temp. | 2-8°C |
| solubility | ethanol: complete50mg/mL |
| pka | 7.11±0.40(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 50mg/L(25 ºC) |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C11H18N2O2S/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16) |
| InChIKey | IUJDSEJGGMCXSG-UHFFFAOYSA-N |
| SMILES | CCCC(C)C1(CC)C(=O)NC(=S)NC1=O |
| CAS DataBase Reference | 76-75-5(CAS DataBase Reference) |
| EPA Substance Registry System | 4,6(1H,5H)-Pyrimidinedione, 5-ethyldihydro-5-(1-methylbutyl)-2-thioxo- (76-75-5) |
Description and Uses
A thio-derivative of Barbituric acid. Controlled substance (depressant). Anesthetic
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn,T,F |
| Risk Statements | 22-39/23/24/25-23/24/25-11 |
| Safety Statements | 36/37/39-45-36/37-16-7 |
| RIDADR | UN 1230 3/PG 2 |
| WGK Germany | 3 |
| RTECS | CQ6300000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2933595960 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 76-75-5(Hazardous Substances Data) |
| Toxicity | cyt-hmn:leu 1500 mg/L TGANAK18(1),13,84 |






