S2066349
Friedelin , analyticalstandard , 559-74-0
Synonym(s):
(4β,5β,8α,9β,10α,13α,14β)-5,9,13-Trimethyl-24,25,26-trinoroleanan-3-one;DA-friedooleanan-3-one;Friedelan-3-one
CAS NO.:559-74-0
Empirical Formula: C30H50O
Molecular Weight: 426.72
MDL number: MFCD00017296
EINECS: 209-205-1
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB2142.03 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 262-265 °C (lit.) |
| alpha | D -27.8° (chloroform) |
| Boiling point: | 477.2±13.0 °C(Predicted) |
| Density | 0.963±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| optical activity | -2214 (c 0.8, CHCl3) |
| Merck | 13,4293 |
| BRN | 1916451 |
| Major Application | food and beverages |
| InChIKey | OFMXGFHWLZPCFL-SVRPQWSVSA-N |
| SMILES | C[C@H]1C(=O)CC[C@@H]2[C@]1(C)CC[C@H]3[C@@]2(C)CC[C@@]4(C)[C@@H]5CC(C)(C)CC[C@]5(C)CC[C@]34C |
| LogP | 10.287 (est) |
Description and Uses
Friedelin is a flavonoid extract which displays radical scavenging and anti-typhoid activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |







