S2193049
UnitedStatesPharmacopeia(USP)ReferenceStandard , 79617-89-3
Synonym(s):
(±)-Sertraline hydrochloride;1R,4R)-rel-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenamine hydrochloride
CAS NO.：79617-89-3
Empirical Formula: C17H17Cl2N.HCl
Molecular Weight: 342.69
MDL number: MFCD00895772
| Pack Size | Price | Stock | Quantity |
| 30mg | RMB10501.34 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 275-277 ºC |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C17H17Cl2N.ClH/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11;/h2-6,8,10,12,17,20H,7,9H2,1H3;1H/t12-,17-;/m0./s1 |
| InChIKey | BLFQGGGGFNSJKA-XHXSRVRCSA-N |
| SMILES | Cl.CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c3ccccc13 |
| LogP | 5.29 |
Description and Uses
Potent and selective inhibitors of serotonin uptake.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H412 |
| Precautionary statements | P264-P270-P273-P301+P312-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-52/53 |
| WGK Germany | WGK 3 |
| HS Code | 2921490002 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
