LN-631734
rac-cis-N-Desmethyl Sertraline Hydrochloride , 0.95 , 91797-57-8
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 301-303°C |
| Flash point: | 9℃ |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Major Application | clinical testing |
| InChI | 1S/C16H15Cl2N.ClH/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13;/h1-5,7,9,11,16H,6,8,19H2;1H/t11-,16-;/m0./s1 |
| InChIKey | YKXHIERZIRLOLD-RISSCEEYSA-N |
| SMILES | N[C@H]1CC[C@@H](C2=CC(Cl)=C(Cl)C=C2)C3=C1C=CC=C3.[H]Cl |
| EPA Substance Registry System | 1-Naphthalenamine, 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-, hydrochloride (1:1), (1R,4R)-rel- (91797-57-8) |
Description and Uses
A racemate of a metabolite of Sertraline. N-Desmethyl sertraline is significantly less active analogue as compared to the methylated compound, Sertraline
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
