S220078
N,N-Dimethylhydroxylamine hydrochloride , 99% , 16645-06-0
CAS NO.：16645-06-0
Empirical Formula: C2H8ClNO
Molecular Weight: 97.54
MDL number: MFCD00012600
EINECS: 240-691-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1770.81 | In Stock |
|
| 25g | RMB4775.46 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107-109 °C (lit.) |
| form | solid |
| BRN | 3905683 |
| InChI | InChI=1S/C2H7NO.ClH/c1-3(2)4;/h4H,1-2H3;1H |
| InChIKey | HWWVAHCWJLGKLW-UHFFFAOYSA-N |
| SMILES | N(O)(C)C.Cl |
Description and Uses
N,N-Dimethylhydroxylamine hydrochloride was used in the synthesis of 4,4-dimethyl-2,5,5-triphenyl-l.3-dioxa-4-azonia-2-bora-5-boratacyclopentane. It was also used as a polymer-chain terminator.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
