PRODUCT Properties
| Melting point: | decomposes at 100–105℃ [MER06] |
| Boiling point: | 2900 °C(lit.) |
| Density | 1.03 g/mL at 25 °C |
| vapor pressure | 0Pa at 20℃ |
| Flash point: | 4°C (Toluene) |
| storage temp. | 15-25°C |
| solubility | H2O: soluble |
| form | wire |
| color | pale |
| PH | 4.8 (20°C in H2O) |
| Water Solubility | g/100g solution H2O: 45.66 (0°), 50.5 ± 0.2 (25°C), 77.21 (91°C); solid phase, Co(NO3)2 ·6H2O (0°C, 25°C), Co(NO3)2 · 3H2O (91°C) [KRU93] |
| Merck | 13,2469 |
| Major Application | industrial qc pharmaceutical |
| InChI | InChI=1S/Co.2NO3/c;2*2-1(3)4/q+2;2*-1 |
| InChIKey | UFMZWBIQTDUYBN-UHFFFAOYSA-N |
| SMILES | [N+]([O-])(=O)[O-].[N+]([O-])([O-])=O.[Co+2] |
| CAS DataBase Reference | 10141-05-6(CAS DataBase Reference) |
| EPA Substance Registry System | Cobalt(II) nitrate (10141-05-6) |
Description and Uses
Sympathetic inks, cobalt pigments, catalysts, additive to soils and animal feeds, vitamin preparations, hair dyes, porcelain decoration.
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H317-H334-H341-H410 |
| Precautionary statements | P261-P272-P280-P284-P201-P202-P273-P302+P352-P333+P313-P362+P364-P304+P340-P342+P311-P308+P313-P391-P405-P501 |
| Hazard Codes | T,N,Xn,Xi |
| Risk Statements | 45-23/24/25-34-51/53-43-40-36/38-52/53-49-60-42/43 |
| Safety Statements | 53-23-26-36/37/39-45-61-36/37-36 |
| RIDADR | UN 3264 8/PG 3 |
| WGK Germany | 3 |
| RTECS | GF8750000 |
| TSCA | TSCA listed |
| HazardClass | 5.1 |
| PackingGroup | II |
| HS Code | 28342910 |
| Storage Class | 6.1D - Non-combustible, acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 2 Carc. 1B Eye Dam. 1 Met. Corr. 1 Muta. 2 Repr. 1B Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 10141-05-6(Hazardous Substances Data) |
| Toxicity | LD in rabbits (mg/kg): 250 orally, 75 s.c. (Venugopal, Luckey) |
| REACH Registrations | Active |
