S2336149
Bromfenvinphos-ethyl , PESTANAL ,analyticalstandard , 33399-00-7
CAS NO.:33399-00-7
Empirical Formula: C10H12BrCl2O3PS
Molecular Weight: 394.05
MDL number: MFCD00055262
EINECS: 225-399-0
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 122.5°C |
| Density | 1.590 |
| refractive index | n20/D 1.565 |
| Flash point: | 100 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| Specific Gravity | 1.54 (20℃) |
| Water Solubility | 0.34mg/L(20 ºC) |
| BRN | 2294153 |
| Major Application | agriculture environmental |
| InChI | 1S/C10H12BrCl2O3PS/c1-3-14-17(18,15-4-2)16-10-6-8(12)7(11)5-9(10)13/h5-6H,3-4H2,1-2H3 |
| InChIKey | KWGUFOITWDSNQY-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)Oc1cc(Cl)c(Br)cc1Cl |
| EPA Substance Registry System | Bromophos-ethyl (4824-78-6) |
Description and Uses
Bromophos-ethyl may be used as a reference standard for the determination of the insecticidel in fortified crop and water samples using enzyme-linked immunosorbent assay (ELISA).
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H312-H410 |
| Precautionary statements | P273-P280-P301+P310+P330-P302+P352+P312 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,N |
| Risk Statements | 21-25-50/53 |
| Safety Statements | 28-36/37-45-60-61 |
| RIDADR | 3018 |
| WGK Germany | 3 |
| RTECS | TE7000000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29201900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 4824-78-6(Hazardous Substances Data) |






