PRODUCT Properties
| Melting point: | 159-161° |
| Boiling point: | 632.6±55.0 °C(Predicted) |
| Density | 1.1322 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO: ≥10mg/mL |
| pka | 14.62±0.70(Predicted) |
| form | powder |
| color | white |
| InChIKey | ZBIAKUMOEKILTF-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1NC(=O)CN2CCN(CCCC(c3ccc(F)cc3)c4ccc(F)cc4)CC2 |
| CAS DataBase Reference | 3416-26-0 |
Description and Uses
Lidoflazine is a L-type Ca2+ channel antagonist.Also, it is derived from 1,1''-(4-Chlorobutylidene)bis(4-fluorobenzene) (C364775), which is a derivative of Zerumbone with potential anti-tumor effects towards HeLa cancer cells.





