S2475149
clone14H6,frommouse
| Pack Size | Price | Stock | Quantity |
| 100μL | RMB3676.66 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100°C |
| Boiling point: | 875.7±65.0 °C(Predicted) |
| Density | 1.502±0.06 g/cm3(Predicted) |
| Flash point: | 2℃ |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| pka | 2.76±0.70(Predicted) |
| color | White to Pale Beige |
| Stability: | Hygroscopic |
| InChIKey | BYFGTSAYQQIUCN-HGIHDBQLSA-N |
| SMILES | COc1c(C)c2COC(=O)c2c(O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)C(O)=O)c1C\C=C(/C)CCC(O)=O |
Description and Uses
A metabolite of Mycophenolic Acid, an antibiotic produced by Penicillium brevi-compactum, P. Stoloniferum and related spp. A selective inhibitor of lymphocyte proliferation by blocking inosine monoph osphate dehydrogenase, an enzyme involved in the de novo synthesis of purine nucleotides.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H319 |
| Precautionary statements | P210-P261-P302+P352+P312-P304+P340+P312-P337+P313-P403+P235 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-20/21/22-36 |
| Safety Statements | 16-26-36/37 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 2 |
| HS Code | 29389090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |




