S2478151
PESTANAL ,analyticalstandard , 13684-56-5
CAS NO.:13684-56-5
Empirical Formula: C16H16N2O4
Molecular Weight: 300.31
MDL number: MFCD00055462
EINECS: 237-198-5
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB1007.46 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120 °C |
| Boiling point: | 441.54°C (rough estimate) |
| Density | 1.1782 (rough estimate) |
| refractive index | 1.6240 (estimate) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.96±0.70(Predicted) |
| color | White to Off-White |
| Water Solubility | 7mg/L(room temperature) |
| BRN | 2395716 |
| Major Application | agriculture environmental |
| InChI | 1S/C16H16N2O4/c1-2-21-15(19)18-13-9-6-10-14(11-13)22-16(20)17-12-7-4-3-5-8-12/h3-11H,2H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | WZJZMXBKUWKXTQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1cccc(OC(=O)Nc2ccccc2)c1 |
| LogP | 3.390 |
| CAS DataBase Reference | 13684-56-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Desmedipham(13684-56-5) |
| EPA Substance Registry System | Desmedipham (13684-56-5) |
Description and Uses
Desmedipham is a carbanilate based herbicide used in the weed control programs in sugar beet.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| RTECS | FD0425000 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 |
| Toxicity | LC50 (96-hour) for rainbow trout 3.8 mg/L and bluegill sunfish 13.4 mg/L (Hartley and Kidd, 1987); acute oral LD50 of pure desmedipham and the formulated product for rats 10,300 and 3,700 mg/kg, respectively (Ashton and Monaco, 1991). |





