S2480451
98% , 13744-68-8
Synonym(s):
6-Sulfanilamidoindazole
CAS NO.：13744-68-8
Empirical Formula: C13H12N4O2S
Molecular Weight: 288.33
MDL number: MFCD00005694
EINECS: 237-314-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB740.29 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-195 °C(lit.) |
| Boiling point: | 581.1±56.0 °C(Predicted) |
| Density | 1.546±0.06 g/cm3(Predicted) |
| pka | 8.77±0.30(Predicted) |
| InChI | 1S/C13H12N4O2S/c14-10-2-5-12(6-3-10)20(18,19)17-11-4-1-9-8-15-16-13(9)7-11/h1-8,17H,14H2,(H,15,16) |
| InChIKey | RLNLIVBLEZDLMZ-UHFFFAOYSA-N |
| SMILES | Nc1ccc(cc1)S(=O)(=O)Nc2ccc3cn[nH]c3c2 |
Description and Uses
N1-(6-Indazolyl)sulfanilamide ( 6-Sulfanilamidoindazole) causes inflammation in the hind paws and ankles of older rat and sensitizes them to the lethal action of endotoxin.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | DA9510332 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
