S2494751
1.0 mg/mLinmethanol(asfreebase),ampuleof1 mL,certifiedreferencematerial,Cerilliant , 144025-14-9
Synonym(s):
N-Desmethylcitalopram hydrochloride solution
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB1838.30 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-65°C |
| Boiling point: | 429.4±45.0 °C(Predicted) |
| Density | 1.20±0.1 g/cm3(Predicted) |
| Flash point: | 9℃ |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| form | liquid |
| pka | 10.50±0.10(Predicted) |
| Stability: | Hygroscopic |
| Major Application | clinical testing |
| InChI | 1S/C19H19FN2O/c1-22-10-2-9-19(16-4-6-17(20)7-5-16)18-8-3-14(12-21)11-15(18)13-23-19/h3-8,11,22H,2,9-10,13H2,1H3/t19-/m0/s1 |
| InChIKey | PTJADDMMFYXMMG-IBGZPJMESA-N |
| SMILES | Fc1ccc(cc1)[C@@]2(OCc3c2ccc(c3)C#N)CCCNC |
Description and Uses
N-Desmethylcitalopram hydrochloride is a metabolite of Citalopram, an inhibitor of serotonin (5-HT) uptake. Used as an antidepressant.
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes,Central nervous system |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
