PRODUCT Properties
| Melting point: | 74-75 °C |
| Boiling point: | 231.78°C (rough estimate) |
| Density | 1 g/cm3 |
| refractive index | 1.5215 (estimate) |
| Flash point: | 104°C |
| storage temp. | 2-8°C, protect from light |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C10H14O/c11-10-7-3-6-9(10)8-4-1-2-5-8/h1-7H2 |
| InChIKey | NYSYNXRPXJZYFY-UHFFFAOYSA-N |
| SMILES | C1(=O)CCC/C/1=C1\CCCC\1 |
Description and Uses
Bicyclopentylidene-2-one is derived from Cyclopentanone (C988395), which is a chemical compound used in the synthesis of various simple and complex organic compounds. Also, it is used in the synthesis of peptidase IV inhibitors for the treatment of type 2 diabetes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362 |
