S2515349
UnitedStatesPharmacopeia(USP)ReferenceStandard , 96382-71-7
CAS NO.：96382-71-7
Empirical Formula: C18H17Cl2NO4
Molecular Weight: 382.24
MDL number: MFCD08703065
| Pack Size | Price | Stock | Quantity |
| 15mg | RMB10501.34 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-73C |
| Boiling point: | 444.8±45.0 °C(Predicted) |
| Density | 1.288±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Very Slightly), Water (Slightly) |
| form | Solid |
| pka | 1.48±0.29(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C18H17Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8H,5H2,1-4H3 |
| InChIKey | REQRUBNOOIAHMG-UHFFFAOYSA-N |
| SMILES | Clc1c(cccc1c2c(c(nc(c2C(=O)OC)C)C)C(=O)OCC)Cl |
Description and Uses
Dehydro Felodipine (Felodipine EP Impurity A) is the primary metabolite of Felodipine.
Safety
| Symbol(GHS) |    GHS08,GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H361d-H373-H410 |
| Precautionary statements | P202-P260-P264-P273-P301+P312-P308+P313 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 STOT RE 2 Inhalation |
