S2529749
33683-30-6
Synonym(s):
2,2′,4,4′,5,5′-HexaBDE;2,2′,4,4′,5,5′-Hexabromodiphenyl ether solution;PBDE 153
CAS NO.:33683-30-6
Empirical Formula: C12H4Br6O
Molecular Weight: 643.58
MDL number: MFCD06407722
EINECS: 208-759-1
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 453 °C |
| Density | 2.502±0.06 g/cm3(Predicted) |
| Flash point: | -12 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Light Sensitive |
| Major Application | environmental |
| InChI | 1S/C12H4Br6O/c13-5-1-9(17)11(3-7(5)15)19-12-4-8(16)6(14)2-10(12)18/h1-4H |
| InChIKey | RZXIRSKYBISPGF-UHFFFAOYSA-N |
| SMILES | Brc1cc(Br)c(Oc2cc(Br)c(Br)cc2Br)cc1Br |
| EPA Substance Registry System | Benzene, 1,1'-oxybis[2,4,5-tribromo- (68631-49-2) |
Description and Uses
2,2',4,4',5,5'-Hexabromodiphenyl Ether is a polybrominated diphenyl ether (PBDE) used as a flame retardant. One of the new POPs under the Stockholm Convention
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H225-H304-H315-H336-H410 |
| Precautionary statements | P210-P261-P273-P301+P310-P331-P501 |
| target organs | Central nervous system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn,N |
| Risk Statements | 11-38-50/53-65-67 |
| Safety Statements | 60-61-62-33-29-16-9 |
| RIDADR | UN 1262 3/PG 2 |
| WGK Germany | 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |








