PRODUCT Properties
| Density | 0.916 g/mL at 25 °C(lit.) |
| vapor pressure | 0-0.009Pa at 20-50℃ |
| refractive index | n |
| Flash point: | >230 °F |
| Boiling point: | 174 °C(Press: 7 Torr) |
| form | Liquid |
| Henry's Law Constant | 5.8×10-2 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | InChI=1S/C16H35O3P/c1-5-9-11-15(7-3)13-18-20(17)19-14-16(8-4)12-10-6-2/h15-16,20H,5-14H2,1-4H3 |
| InChIKey | HZIUHEQKVCPTAJ-UHFFFAOYSA-N |
| SMILES | P(=O)(OCC(CC)CCCC)OCC(CC)CCCC |
| LogP | 6.5 at 25℃ |
| CAS DataBase Reference | 3658-48-8(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphonic acid, bis(2-ethylhexyl) ester (3658-48-8) |
Description and Uses
Bis(2-ethylhexyl) Phosphite is used as a supported liquid membranes (SLMs) for electromembrane extraction (EME) of basic drugs from human plasma samples.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 2 |
| RTECS | SZ6840000 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 3658-48-8(Hazardous Substances Data) |
| Toxicity | guinea pig,LD50,intraperitoneal,700mg/kg (700mg/kg),BEHAVIORAL: SOMNOLENCE (GENERAL DEPRESSED ACTIVITY)BEHAVIORAL: CONVULSIONS OR EFFECT ON SEIZURE THRESHOLD,AMA Archives of Industrial Health. Vol. 18, Pg. 464, 1958. |
| REACH Registrations | Active |





