S3235451
≥95%,FCC,FG , 141-14-0
CAS NO.：141-14-0
Empirical Formula: C13H24O2
Molecular Weight: 212.33
MDL number: MFCD00027010
EINECS: 205-461-3
| Pack Size | Price | Stock | Quantity |
| 1SAMPLE-K | RMB308.14 | In Stock |
|
| 1KG | RMB622.20 | In Stock |
|
| 4KG | RMB3673.31 | In Stock |
|
| 9KG | RMB6114.07 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 242 °C(lit.) |
| Density | 0.877 g/mL at 25 °C(lit.) |
| FEMA | 2316 | CITRONELLYL PROPIONATE |
| refractive index | n |
| Flash point: | >230 °F |
| solubility | Almost insoluble in water, soluble in alcohol and oils |
| color | Colorless liquid |
| Odor | at 100.00 %. floral green neroli waxy fruity rose |
| Odor Type | floral |
| biological source | synthetic |
| JECFA Number | 61 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C13H24O2/c1-5-13(14)15-10-9-12(4)8-6-7-11(2)3/h7,12H,5-6,8-10H2,1-4H3 |
| InChIKey | POPNTVRHTZDEBW-UHFFFAOYSA-N |
| SMILES | CCC(=O)OCCC(C)CC\C=C(\C)C |
| LogP | 4.81 |
| CAS DataBase Reference | 141-14-0(CAS DataBase Reference) |
| EPA Substance Registry System | 6-Octen-1-ol, 3,7-dimethyl-, propanoate (141-14-0) |
Description and Uses
Citronellyl Propionate is a synthetic flavoring agent that is a mod- erately stable, colorless liquid of light rose-fruity odor. it is practi- cally insoluble in water but is miscible with alcohol. it is stored in glass or tin containers. it has application in baked goods, candy, beverages, and ice cream at 3–19 ppm.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| WGK Germany | 2 |
| RTECS | RH3487500 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Toxicity | Both the acute oral LD50 value in rats and the acute dermal LD50 value in rabbits exceeded 5 g/kg (Moreno, 1973). |
