S3259551
n-Heptylβ-D-thioglucopyranoside , ≥99%(GC) , 85618-20-8
Synonym(s):
Heptyl thioglucoside;Heptyl-β-D -1-thioglucopyranoside
CAS NO.:85618-20-8
Empirical Formula: C13H26O5S
Molecular Weight: 294.41
MDL number: MFCD00043236
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB715.01 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96.1-98.3°C |
| Boiling point: | 479.9±45.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | methanol: 0.1 g/mL, clear, yellow |
| form | Solid |
| pka | 13.02±0.70(Predicted) |
| color | White Waxy |
| BRN | 6057483 |
| InChI | 1S/C13H26O5S/c1-2-3-4-5-6-7-19-13-12(17)11(16)10(15)9(8-14)18-13/h9-17H,2-8H2,1H3/t9-,10-,11+,12-,13+/m1/s1 |
| InChIKey | HPEGNLMTTNTJSP-LBELIVKGSA-N |
| SMILES | CCCCCCCS[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| CAS DataBase Reference | 85618-20-8(CAS DataBase Reference) |
Description and Uses
n-Heptyl β-D-thioglucopyranoside is useful non-ionic detergent for solubilization and reconstitution of membrane proteins of Escherichia coli.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |






