S331778
Isopropyl bromoacetate , 99% , 29921-57-1
CAS NO.：29921-57-1
Empirical Formula: C5H9BrO2
Molecular Weight: 181.03
MDL number: MFCD00009886
EINECS: 249-956-2
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 65 °C (15 mmHg) |
| Density | 1.399 g/mL at 25 °C(lit.) |
| refractive index | 1.444-1.446 |
| Flash point: | 113 °C |
| form | Liquid |
| Specific Gravity | 1.399 |
| color | Clear colorless to yellow |
| InChI | InChI=1S/C5H9BrO2/c1-4(2)8-5(7)3-6/h4H,3H2,1-2H3 |
| InChIKey | JCWLEWKPXYZHGQ-UHFFFAOYSA-N |
| SMILES | C(OC(C)C)(=O)CBr |
| NIST Chemistry Reference | BrCH2C(O)OCH(CH3)2(29921-57-1) |
| EPA Substance Registry System | Acetic acid, bromo-, 1-methylethyl ester (29921-57-1) |
Description and Uses
Isopropyl bromoacetate has been used in the synthesis of biaryl sulphonamide derivatives. It is also used to synthesize Triisopropylphosphonoacetate and Isopropyl 2-(bis(2,2,2-trifluoroethyl) phosphoryl) acetate.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 37/39-26-45-36/37/39 |
| RIDADR | 1760 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
