S333379
2-(Di-tert-butylphosphino)-1-phenylindole , 95% , 740815-37-6
Synonym(s):
cataCXium PIntB;N-Phenyl-2-(di-tert-butylphosphino)indole;N-Phenylindol-2-yl-di-tert-butylphosphine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1034.05 | In Stock |
|
| 5g | RMB3740.42 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92℃ (methanol ) |
| Boiling point: | 455.4±27.0 °C(Predicted) |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | Acetonitrile (Slightly), Benzene (Slightly), Chloroform (Slightly) |
| form | Powder |
| color | white to yellow |
| Sensitive | air sensitive |
| BRN | 9924511 |
| InChI | 1S/C22H28NP/c1-21(2,3)24(22(4,5)6)20-16-17-12-10-11-15-19(17)23(20)18-13-8-7-9-14-18/h7-16H,1-6H3 |
| InChIKey | HDZRDZCQFYUOHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(c1cc2ccccc2n1-c3ccccc3)C(C)(C)C |
Description and Uses
N-Phenyl-2-(di-tert-butylphosphino)indole is a catalyst for the selective monoarylation of ammonia with different aryl bromides and chlorides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |






