![Bicyclo[3.3.1]nonane-2,6-dione](https://img.chemicalbook.com/CAS/GIF/16473-11-3.gif)
S356779
Bicyclo[3.3.1]nonane-2,6-dione , 97% , 16473-11-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB665.86 | In Stock |
|
| 500mg | RMB1759.04 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 151 °C |
| Boiling point: | 180/20mm |
| Density | 1.0505 (rough estimate) |
| refractive index | 1.5350 (estimate) |
| storage temp. | Store at room temperature |
| solubility | Chloroform, Methanol |
| form | Solid |
| color | White |
| InChI | 1S/C9H12O2/c10-8-3-1-6-5-7(8)2-4-9(6)11/h6-7H,1-5H2/t6-,7-/m1/s1 |
| InChIKey | QWNPVTXLBMSEPN-RNFRBKRXSA-N |
| SMILES | O=C1CC[C@@H]2C[C@H]1CCC2=O |
| CAS DataBase Reference | 16473-11-3(CAS DataBase Reference) |
Description and Uses
Bicyclo[3.2.1]octane-2,6-dione is an intermediate in the synthesis of chiral Adamantane derivative.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2914290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |