PRODUCT Properties
| Melting point: | 111-113 °C (lit.) |
| Boiling point: | 544.68°C (rough estimate) |
| Density | 0.8770 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| form | powder |
| BRN | 4605091 |
| Stability: | Stable. Hygroscopic. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C24H52N.ClH/c1-5-9-13-17-21-25(22-18-14-10-6-2,23-19-15-11-7-3)24-20-16-12-8-4;/h5-24H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ODTSDWCGLRVBHJ-UHFFFAOYSA-M |
| SMILES | [N+](CCCCCC)(CCCCCC)(CCCCCC)CCCCCC.[Cl-] |
| EPA Substance Registry System | Tetrahexylammonium chloride (5922-92-9) |
Description and Uses
- Development of supramolecular solvents: It serves as a key component in the synthesis of ribbon-shaped supramolecular solvents, which are employed for greener microextraction techniques of water-soluble organic pollutants, highlighting its role in environmental chemistry (Algar et al., 2023).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






