S3850551
UnitedStatesPharmacopeia(USP)ReferenceStandard , 36112-95-5
Synonym(s):
3-(1-Naphthyloxy)-1,2-propanediol;3-Naphthalen-1-yloxypropane-1,2-diol;Propanolol glycol
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB10777.69 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-100℃ |
| Boiling point: | 437.7±25.0 °C(Predicted) |
| Density | 1.240±0.06 g/cm3(Predicted) |
| storage temp. | 2-30°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Sparingly) |
| pka | 13.48±0.20(Predicted) |
| BRN | 2107930 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C13H14O3/c14-8-11(15)9-16-13-7-3-5-10-4-1-2-6-12(10)13/h1-7,11,14-15H,8-9H2 |
| InChIKey | BYNNMWGWFIGTIC-UHFFFAOYSA-N |
| SMILES | O(CC(O)CO)c1c2c(ccc1)cccc2 |
Description and Uses
3-(1-Naphthalenyloxy)-1,2-propanediol is an impurity of Propranolol (P831800), an βAdrenergic blocker used as a antihypertensive and antilanginal agent.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H311 |
| Precautionary statements | P280-P302+P352+P312-P361+P364-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 21 |
| Safety Statements | 36/37 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 1 |
| RTECS | TZ0800000 |
| HS Code | 2909490000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal |




![1,1'-[(1-Methylethyl)iMino]bis[3-(1-naphthalenyloxy)-2-propanol](https://img.chemicalbook.com/CAS/GIF/83314-78-7.gif)

