S3865051
PESTANAL ,analyticalstandard , 79538-32-2
CAS NO.:79538-32-2
Empirical Formula: C17H14ClF7O2
Molecular Weight: 418.73
MDL number: MFCD00274607
EINECS: 616-699-6
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-46°C |
| Boiling point: | bp1.33hPa 156° |
| Density | 1.23 |
| vapor pressure | 8×10-3 Pa (20 °C) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| Water Solubility | 0.02 mg l-1 (20 °C) |
| Merck | 13,9192 |
| BRN | 8398039 |
| InChI | 1S/C17H14ClF7O2/c1-6-11(19)13(21)7(14(22)12(6)20)5-27-15(26)10-8(16(10,2)3)4-9(18)17(23,24)25/h4,8,10H,5H2,1-3H3/b9-4-/t8-,10-/m0/s1 |
| InChIKey | ZFHGXWPMULPQSE-UKSCLKOJSA-N |
| SMILES | Cc1c(F)c(F)c(COC(=O)C2C(\C=C(/Cl)C(F)(F)F)C2(C)C)c(F)c1F |
| LogP | 6.500 |
| EPA Substance Registry System | Tefluthrin (79538-32-2) |
Description and Uses
Tefluthrin is a pyrethroid based insecticide. Tefluthrin is used in the control of a broad range of soil pests, including members of the Coleoptera, Lepidoptera, and Diptera.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H410 |
| Precautionary statements | P260-P262-P273-P280-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T+ |
| Risk Statements | 23/24-28 |
| Safety Statements | 22-28-36/37/39-45 |
| RIDADR | UN 3349 |
| WGK Germany | 3 |
| RTECS | GZ1227850 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29162090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 79538-32-2(Hazardous Substances Data) |
| Toxicity | LD50 technical grade in rats (mg/kg): 35 orally; 200-1000 dermally (Marrs, Gordon) |







