S392879
Tri-Boc-hydrazinoacetic acid , ≥97.0%(N) , 261380-41-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB1231.18 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-115 °C |
| storage temp. | 2-8°C |
| form | powder |
| Appearance | White to off-white Solid |
| Major Application | peptide synthesis |
| InChI | 1S/C17H30N2O8/c1-15(2,3)25-12(22)18(10-11(20)21)19(13(23)26-16(4,5)6)14(24)27-17(7,8)9/h10H2,1-9H3,(H,20,21) |
| InChIKey | FSRNHDLQBNOYJK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CC(O)=O)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
