BioReagent,suitableforfluorescence,≥97.5%(HPLC) , 479-13-0
Synonym(s):
7,12-Dihydroxycoumestan
CAS NO.:479-13-0
Empirical Formula: C15H8O5
Molecular Weight: 268.22
MDL number: MFCD00016885
EINECS: 207-525-6
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB707.98 | In Stock |
|
| 5mg | RMB1694.72 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | ≥350 °C(lit.) |
| Boiling point: | 331.39°C (rough estimate) |
| Density | 1.2586 (rough estimate) |
| refractive index | 1.7680 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO: soluble |
| form | Light beige solid. |
| pka | 8.25±0.20(Predicted) |
| color | Pale Yellow to Dark Brown |
| BRN | 266702 |
| InChI | InChI=1S/C15H8O5/c16-7-1-3-9-11(5-7)19-14-10-4-2-8(17)6-12(10)20-15(18)13(9)14/h1-6,16-17H |
| InChIKey | ZZIALNLLNHEQPJ-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(O)=CC=C2C2OC3=CC(O)=CC=C3C1=2 |
| LogP | 2.940 (est) |
| CAS DataBase Reference | 479-13-0(CAS DataBase Reference) |
| EPA Substance Registry System | Coumestrol (479-13-0) |
Description and Uses
Coumestrol is a phytoestrogen that occurs naturally in soybeans, spinach, and clover. It competitively (vs. 17β-
This compound has estrogenic activity. It exhibits bright blue fluorescence in neutral or acid solution, and greenish-yellow fluorescence in strong alkali solution.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DF8077000 |
| F | 10 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






