A0843350
WAY200070 , 98% , 440122-66-7
Synonym(s):
7-Bromo-2-(4-hydroxyphenyl)-1,3-benzoxazol-5-ol;7-bromo-2-(4-hydroxyphenyl)-5-benzoxazolol
CAS NO.：440122-66-7
Empirical Formula: C13H8BrNO3
Molecular Weight: 306.11
MDL number: MFCD16618385
EINECS: 604-604-1
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB270.40 | In Stock |
|
| 5mg | RMB653.60 | In Stock |
|
| 10mg | RMB929.60 | In Stock |
|
| 25mg | RMB1971.20 | In Stock |
|
| 50mg | RMB3459.20 | In Stock |
|
| 100mg | RMB5039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 463.6±35.0 °C(Predicted) |
| Density | 1.720±0.06 g/cm3(Predicted) |
| storage temp. | Store at RT |
| solubility | DMSO: ≥20mg/mL |
| form | solid |
| pka | 7.26±0.40(Predicted) |
| color | White to off-white |
| InChI | 1S/C13H8BrNO3/c14-10-5-9(17)6-11-12(10)18-13(15-11)7-1-3-8(16)4-2-7/h1-6,16-17H |
| InChIKey | BAAILVWEAXFTSF-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)-c2nc3cc(O)cc(Br)c3o2 |
Description and Uses
WAY 200070 is an aryl diphenolic azole and a selective ERβ agonist. This compound is suitable for estrogen receptor signaling research.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P264-P270-P280-P301+P310-P305+P351+P338-P337+P313 |
| Hazard Codes | T |
| Risk Statements | 25-36 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
