A5517112
2-Methoxyestradiol (2-MeOE2) , ≥98% , 362-07-2
Synonym(s):
1,3,5(10)-Estratriene-2,3,17-triol 2-methyl ether;2,3,17β-Trihydroxy-1,3,5(10)-estratriene 2-methyl ether;2-Hydroxyestradiol 2-methyl ether;2-Methoxy-3,17β-dihydroxyestra-1,3,5(10)-triene;3,17β-Dihydroxy-2-methoxy-1,3,5(10)-estratriene
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB111.20 | In Stock |
|
| 25mg | RMB204.80 | In Stock |
|
| 50MG | RMB343.20 | In Stock |
|
| 100MG | RMB624.80 | In Stock |
|
| 500MG | RMB2178.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-190°C |
| Boiling point: | 464.4±45.0 °C(Predicted) |
| Density | 1.178±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO: 10 mg/mL |
| form | crystalline |
| pka | 10.29±0.60(Predicted) |
| color | light yellow |
| λmax | 286nm(EtOH)(lit.) |
| InChI | InChI=1/C19H26O3/c1-19-8-7-12-13(15(19)5-6-18(19)21)4-3-11-9-16(20)17(22-2)10-14(11)12/h9-10,12-13,15,18,20-21H,3-8H2,1-2H3/t12-,13+,15-,18-,19-/s3 |
| InChIKey | CQOQDQWUFQDJMK-SSTWWWIQSA-N |
| SMILES | C[C@@]12[C@H](CC[C@@]1([H])[C@]1([H])CCC3C=C(O)C(OC)=CC=3[C@@]1([H])CC2)O |&1:1,2,5,7,20,r| |
| CAS DataBase Reference | 362-07-2(CAS DataBase Reference) |
Description and Uses
2-Methoxyestradiol depolymerizes microtubules and blocks HIF-1α nuclear accumulation and HIF-transcriptional activity. Phase 2.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H335-H350-H360-H372-H410 |
| Precautionary statements | P273-P280-P301+P310-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | T,Xi,N |
| Risk Statements | 23/24/25-36/37/38-48-61-60-46-45-51/53 |
| Safety Statements | 22-26-36/37/39-45-53-36-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | KG7537500 |
| HS Code | 2937.23.5050 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 STOT SE 3 |







