S412678
(+)-Cuparene , ≥99.0%(sumofenantiomers,GC) , 16982-00-6
Synonym(s):
(R)-1-(p-Tolyl)-1,2,2-trimethylcyclopentane
CAS NO.：16982-00-6
Empirical Formula: C15H22
Molecular Weight: 202.34
MDL number: MFCD00043118
EINECS: 241-061-5
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB2395.83 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 275 °C(lit.) |
| Density | 0.937 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 110℃ |
| storage temp. | 2-8°C |
| optical activity | [α]20/D +64±2°, neat |
| BRN | 2326949 |
| InChI | 1S/C15H22/c1-12-6-8-13(9-7-12)15(4)11-5-10-14(15,2)3/h6-9H,5,10-11H2,1-4H3/t15-/m0/s1 |
| InChIKey | SLKPBCXNFNIJSV-HNNXBMFYSA-N |
| SMILES | Cc1ccc(cc1)[C@]2(C)CCCC2(C)C |
| LogP | 6.210 |
Description and Uses
Cuparene ((R)-Cuparene) is a sesquiterpenoid and can be isolated from Cupressaceae[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-23 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |
