S4257352
ANTI-VEGFR2(FLK1/KDR)(C-TERMINAL)antibodyproducedinrabbit , IgGfractionofantiserum,bufferedaqueoussolution
Synonym(s):
VEGFR2;Secalciferol;Vascular endothelial growth factor receptor 2;(24R)-,24,25-Dihydroxycholecalciferol;Fetal liver kinase 1
| Pack Size | Price | Stock | Quantity |
| 400μL | RMB4576.62 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63-65°C |
| Boiling point: | 474.91°C (rough estimate) |
| Density | 1.0362 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| storage temp. | Amber Vial, -20°C Freezer, Under Inert Atmosphere |
| solubility | Soluble in DMSO |
| form | Powder |
| pka | 14.67±0.29(Predicted) |
| color | White to off-white |
| biological source | synthetic |
| BRN | 4567039 |
| Stability: | Light Sensitive, Temperature Sensitive |
| InChIKey | FCKJYANJHNLEEP-AOWQBJNISA-N |
| SMILES | CC(C)(O)[C@H](O)CC[C@H]([C@@H]1[C@]2(C)[C@]([H])(/C(=C/C=C3/C[C@@H](O)CCC/3=C)/CCC2)CC1)C |
Description and Uses
A labelled metabolite of Vitamin D, a possible anti-inflammatory steroid.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301+H311-H330-H372 |
| Precautionary statements | P280-P301+P310+P330-P302+P352+P312-P304+P340+P310-P314 |
| Hazard Codes | T+ |
| Risk Statements | 28 |
| Safety Statements | 28-36/37-45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | VS2895000 |








