S428380
D-Penicillamine disulfide , 97% , 20902-45-8
Synonym(s):
S,S′-Bi(D -penicillamine);3,3′-Dithiobis(2-amino-3-methylbutanoic acid);3,3′-Dithiobis(2-amino-3-methylbutyric acid);3,3′-Dithiobis-D -valine;NSC 87505
CAS NO.:20902-45-8
Empirical Formula: C10H20N2O4S2
Molecular Weight: 296.41
MDL number: MFCD00004264
EINECS: 244-107-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB707.18 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204 °C (dec.)(lit.) |
| alpha | D23 +27° (c = 1.46 in 1N HCl) |
| Boiling point: | 467.0±45.0 °C(Predicted) |
| Density | 1.353±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Aqueous Base (Slightly), Water (Slightly) |
| pka | 1.76±0.12(Predicted) |
| form | powder or crystals |
| color | White to Off-White |
| optical activity | [α]25/D 75°, c = 1 in 1 M NaOH |
| Merck | 13,7161 |
| BRN | 4461521 |
| Stability: | Hygroscopic |
| Major Application | cell analysis |
| InChI | 1S/C10H20N2O4S2/c1-9(2,5(11)7(13)14)17-18-10(3,4)6(12)8(15)16/h5-6H,11-12H2,1-4H3,(H,13,14)(H,15,16)/t5-,6-/m0/s1 |
| InChIKey | POYPKGFSZHXASD-WDSKDSINSA-N |
| SMILES | CC(C)(SSC(C)(C)[C@@H](N)C(O)=O)[C@@H](N)C(O)=O |
Description and Uses
D-Penicillamine Disulfide is used in the treatment of neurodegenerative diseases such as Parkinson’s and Motor Neuron Disease. Inactivator of α1-antiproteinase, preventing deleterious effects of peroxynitrite.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2930904915 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







