S448379
1028206-56-5
Synonym(s):
(2-Dicyclohexylphosphino-2′,4′,6′-triisopropyl-1,1′-biphenyl)[2-(2-aminoethyl)phenyl)]palladium(II) chloride;(XPhos) palladium(II) phenethylamine chloride;Chloro(2-dicyclohexylphosphino-2′,4′,6′-triisopropyl-1,1′-biphenyl)[2-(2-aminoethyl)phenyl)]palladium(II);XPhos Palladacycle;XPhos precatalyst
CAS NO.:1028206-56-5
Empirical Formula: C41H59ClNPPd
Molecular Weight: 738.77
MDL number: MFCD13194128
EINECS: 633-034-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB316.06 | In Stock |
|
| 1g | RMB1083.70 | In Stock |
|
| 25g | RMB17304.72 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205-210°C |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | Powder |
| color | white |
| InChIKey | WGWWUSKFSLEOKS-UHFFFAOYSA-N |
| SMILES | P(C1CCCCC1)(C1CCCCC1)(C1C=CC=CC=1C1C(=CC(C(C)C)=CC=1C(C)C)C(C)C)[Pd+2]1(NCCC2=CC=CC=[C-]12)[Cl-] |
| CAS DataBase Reference | 1028206-56-5 |
Description and Uses
XPhos Pd G1 is used as androgen receptor modulator for treatment of disorders including prostate cancer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H412 |
| Precautionary statements | P261-P264-P271-P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-52/53 |
| Safety Statements | 26-61 |
| WGK Germany | 3 |
| HS Code | 2843909000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





