S458579
1142811-12-8
Synonym(s):
t-BuXPhos Palladacycle;t-BuXPhos precatalyst;[2-(Di-tert-butylphosphino)-2′,4′,6′-triisopropyl-1,1′-biphenyl][2-(2-aminoethyl)phenyl)]palladium(II) chloride;t-BuXPhos palladium(II) phenethylamine chloride;tBuXPhos-Pd-G1
CAS NO.:1142811-12-8
Empirical Formula: C37H55ClNPPd
Molecular Weight: 686.7
MDL number: MFCD12911909
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB370.99 | In Stock |
|
| 1g | RMB1292.06 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-159°C |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | Powder |
| color | white |
| InChIKey | RUCUZUHGBIVUJI-UHFFFAOYSA-N |
| SMILES | P([Pd+2]1(NCCC2=CC=CC=[C-]12)[Cl-])(C1C=CC=CC=1C1C(=CC(C(C)C)=CC=1C(C)C)C(C)C)(C(C)(C)C)C(C)(C)C |
| CAS DataBase Reference | 1142811-12-8 |
Description and Uses
Catalyst for C-C bond and C-N bond formation.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H351 |
| Precautionary statements | P201-P302+P352-P305+P351+P338-P308+P313 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 2843909000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






