S468580
≥93%,powder , 80731-10-8
Synonym(s):
(−)-Disodium D -3-phosphoglycerate;D -Glycerate 3-phosphate disodium salt
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB182.40 | In Stock |
|
| 1g | RMB3371.91 | In Stock |
|
| 5g | RMB12515.64 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >133°C (subl.) |
| storage temp. | -20°C |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | powder |
| color | white |
| biological source | synthetic (inorganic) |
| Water Solubility | H2O: 50mg/mL, clear, colorless to faintly yellow |
| BRN | 3767836 |
| InChI | 1S/C3H7O7P.2Na/c4-2(3(5)6)1-10-11(7,8)9;;/h2,4H,1H2,(H,5,6)(H2,7,8,9);;/q;2*+1/p-2/t2-;;/m1../s1 |
| InChIKey | RGCJWQYUZHTJBE-YBBRRFGFSA-L |
| SMILES | [Na+].[Na+].O[C@H](COP(O)([O-])=O)C([O-])=O |
Description and Uses
D-(-)-3-Phosphoglyceric Acid Disodium Salt can be used as a hydrothermal treatment.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H371 |
| Precautionary statements | P260-P264-P270-P302+P352-P305+P351+P338-P308+P311 |
| target organs | Eyes,Central nervous system, Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-68/20/21/22-20/21/22 |
| Safety Statements | 26-36-45-36/37 |
| WGK Germany | 3 |
| F | 3-10-21 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 2 STOT SE 3 |
