PRODUCT Properties
| Boiling point: | 110-112 °C7 mm Hg(lit.) |
| Density | 1.256 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 185 °F |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 1.51±0.10(Predicted) |
| color | Colourless to Pale Yellow |
| Specific Gravity | 1.256 |
| InChI | InChI=1S/C8H6FNS/c1-5-10-7-4-6(9)2-3-8(7)11-5/h2-4H,1H3 |
| InChIKey | LDBFGRGBYVULTJ-UHFFFAOYSA-N |
| SMILES | S1C2=CC=C(F)C=C2N=C1C |
| CAS DataBase Reference | 399-75-7(CAS DataBase Reference) |
Description and Uses
5-Fluoro-2-methylbenzothiazole is a useful reactant in the preparation of antileishmanial drug candidates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P403+P235-P501 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2934208090 |
| Storage Class | 10 - Combustible liquids |



![2-(Bromomethyl)-5-fluorobenzo[d]thiazole](https://img.chemicalbook.com/CAS/GIF/143163-70-6.gif)
![2-Chloromethyl-5-fluorobenzo[d]thiazole](https://img.chemicalbook.com/CAS/GIF/110704-60-4.gif)
![2-3-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-1H-indol-1-ylaceticacid](https://img.chemicalbook.com/CAS/GIF/245116-90-9.gif)
![5-([(5-FLUORO-1,3-BENZOTHIAZOL-2-YL)METHYL]SULFANYL)-4H-1,2,4-TRIAZOL-3-AMINE](https://img.chemicalbook.com/StructureFile/ChemBookStructure4/GIF/CB1686764.gif)