PRODUCT Properties
| Melting point: | 214.5°C |
| Boiling point: | 133.5°C |
| storage temp. | -20°C |
| pka | 1.69±0.10(Predicted) |
| form | powder |
| color | yellow to brown |
| InChI | 1S/C6H12N2O4Se2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12) |
| InChIKey | JULROCUWKLNBSN-UHFFFAOYSA-N |
| SMILES | NC(C[Se][Se]CC(N)C(O)=O)C(O)=O |
Description and Uses
Selenocystine is a broad-spectrum anti-cancer agent. Selenocystine induces DNA damage in HepG2 cells, particularly in the form of DNA double strand breaks (DSBs). Selenocystine exhibits great promise as a therapeutic or adjuvant agent targeting DNA repair for cancer treatment[1].
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H331-H373-H410 |
| Precautionary statements | P260-P264-P273-P301+P310-P304+P340+P311-P314 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N |
| Risk Statements | 23/25-33-50/53 |
| Safety Statements | 20/21-28-45-60-61 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | AY6031000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
