S529879
1H,1H,2H,2H-Perfluorododecyltrichlorosilane , 97% , 102488-49-3
Synonym(s):
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-Heneicosafluorododecyltrichlorosilane
CAS NO.：102488-49-3
Empirical Formula: C12H4Cl3F21Si
Molecular Weight: 681.57
MDL number: MFCD07368770
| Pack Size | Price | Stock | Quantity |
| 1g | RMB530.35 | In Stock |
|
| 5g | RMB1740.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50-55°C |
| Boiling point: | 90-92°C / 1 |
| Flash point: | >110℃ |
| form | solid |
| Specific Gravity | 1.7 |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | 1S/C12H4Cl3F21Si/c13-37(14,15)2-1-3(16,17)4(18,19)5(20,21)6(22,23)7(24,25)8(26,27)9(28,29)10(30,31)11(32,33)12(34,35)36/h1-2H2 |
| InChIKey | ZFUVZJADECZZMS-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](Cl)(Cl)Cl |
| CAS DataBase Reference | 102488-49-3 |
| EPA Substance Registry System | 1H,1H,2H,2H-Perfluorododecyltrichlorosilane (102488-49-3) |
Description and Uses
FTCS can be incorporated in polyvinylidiene fluoride(PVDF) with titanium oxide(TiO2) which can be used for membrane distillation for water treatment and anti-fouling based application.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H413 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 22-26-27-36/37/39-45 |
| RIDADR | UN 2987 8 / PGII |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HS Code | 2931900090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
