PRODUCT Properties
| Melting point: | 223-225 °C (lit.) |
| Boiling point: | 523.7±50.0 °C(Predicted) |
| Density | 1.05±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | 15.09±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChIKey | XUARCIYIVXVTAE-ZAPOICBTSA-N |
| SMILES | C[C@@H]1CC[C@]2(CO)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]2[C@H]1C |
| LogP | 9.130 (est) |
| CAS DataBase Reference | 545-46-0 |
Description and Uses
Uvaol can attenuate pleuritis and eosinophillic inflammation in mice that is induced by ovalbumin. It is an essential reagent in the synthesis of aminopropoxytriterpenoids that have anticancer activity.
