PRODUCT Properties
| Melting point: | 162° |
| storage temp. | room temp |
| solubility | DMF: 15 mg/ml,DMSO: 10 mg/ml,Ethanol: 1 mg/ml,PBS (pH 7.2): 1 mg/ml |
| form | Solid |
| color | Off-white to yellow |
| Stability: | Hygroscopic |
| Major Application | clinical testing |
| InChI | InChI=1S/C14H19N3S.ClH/c1-16(2)9-10-17(12-13-6-5-11-18-13)14-7-3-4-8-15-14;/h3-8,11H,9-10,12H2,1-2H3;1H |
| InChIKey | BONORRGKLJBGRV-UHFFFAOYSA-N |
| SMILES | N(CCN(C)C)(CC1SC=CC=1)C1=NC=CC=C1.Cl |
| EPA Substance Registry System | Methapyrilene hydrochloride (135-23-9) |
Description and Uses
Antihistaminic;Histamine H1 antagonist
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 22-36-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | UT1750000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | LD50 oral in rat: 200mg/kg |
