S556978
(R)-(+)-4-Methyl-4-(trichloromethyl)-2-oxetanone , 98% , 93239-42-0
Synonym(s):
(R)-(+)-3-Hydroxy-3-methyl-4,4,4-trichlorobutyric acid β-lactone
| Pack Size | Price | Stock | Quantity |
| 5g | RMB306.65 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-44 °C (lit.) |
| Boiling point: | 120 °C/0.1 mmHg (lit.) |
| Density | 1.6184 (rough estimate) |
| refractive index | 1.4505 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| optical activity | [α]26/D +6.0°, c = 2 in ethanol |
| BRN | 5730854 |
| InChI | 1S/C5H5Cl3O2/c1-4(5(6,7)8)2-3(9)10-4/h2H2,1H3/t4-/m1/s1 |
| InChIKey | MIYJBPXTAZJPGX-SCSAIBSYSA-N |
| SMILES | C[C@@]1(CC(=O)O1)C(Cl)(Cl)Cl |
Description and Uses
(4R)-4-Methyl-4-(trichloromethyl)-2-oxetanone can be used as LPA1 receptor antagonists to treat fibrosis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10-21 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






