PRODUCT Properties
| Boiling point: | 115-125 °C/0.3 mmHg (lit.) |
| Density | 0.914 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| Odor | at 100.00 %. oily waxy |
| Odor Type | oily |
| InChI | InChI=1S/C17H28O2/c1-14(2)8-6-9-15(3)10-7-11-16(4)12-13-19-17(5)18/h8,10,12H,6-7,9,11,13H2,1-5H3/b15-10+,16-12+ |
| InChIKey | ZGIGZINMAOQWLX-NCZFFCEISA-N |
| SMILES | C(OC(=O)C)/C=C(\C)/CC/C=C(\C)/CC/C=C(/C)\C |
| LogP | 6.139 (est) |
Description and Uses
(2E,6E)-3,7,11-Trimethyldodeca-2,6,10-trien-1-yl Acetate is an intermediate in the synthesis of JHSB3 (J211030). JHSB3 is an acyclic sesquiterpenoid that regulates many aspects of insect physiology. Juvenile Hormone regulate development, reproduction, diapause, and polyphenisms.
Safety
| PPE | Eyeshields, Gloves |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |





