S5595058
certifiedreferencematerial,TraceCERT , 66063-05-6
CAS NO.:66063-05-6
Empirical Formula: C19H21ClN2O
Molecular Weight: 328.84
MDL number: MFCD00078724
EINECS: 266-096-3
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB620.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130~135℃ |
| Boiling point: | 528.5±42.0 °C(Predicted) |
| Density | 1.1257 (rough estimate) |
| vapor pressure | 5 x 10-10 Pa (20 °C) |
| refractive index | 1.5790 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) |
| pka | 14.80±0.70(Predicted) |
| Water Solubility | 0.3 mg l-1 (20 °C) |
| color | White to Off-White |
| BRN | 2154416 |
| Major Application | agriculture environmental |
| InChI | 1S/C19H21ClN2O/c20-16-12-10-15(11-13-16)14-22(18-8-4-5-9-18)19(23)21-17-6-2-1-3-7-17/h1-3,6-7,10-13,18H,4-5,8-9,14H2,(H,21,23) |
| InChIKey | OGYFATSSENRIKG-UHFFFAOYSA-N |
| SMILES | Clc1ccc(CN(C2CCCC2)C(=O)Nc3ccccc3)cc1 |
| CAS DataBase Reference | 66063-05-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Pencycuron(66063-05-6) |
| EPA Substance Registry System | Pencycuron (66063-05-6) |
Description and Uses
Pencycuron is an urea based fungicide developed specifically against the plant pathogen Rhizoctonia solani for which it was developed. Pencycuron has also been used for controlling sheath blight of rice.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| RIDADR | UN3002 (liquid phenylurea) |
| WGK Germany | 2 |
| RTECS | YS6440000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |







