S5761549
1,1,1,2,2,3,3,7,7,8,8,9,9,9-Tetradecafluoro-4,6-nonanedione , 97% , 113116-18-0
Synonym(s):
5H,5H-Perdecafluoro-4,6-nonandione
| Pack Size | Price | Stock | Quantity |
| 500mg | RMB1097.62 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 97 °C (lit.) |
| Density | 1.64 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 136 °F |
| pka | 3.72±0.46(Predicted) |
| InChI | 1S/C9H2F14O2/c10-4(11,6(14,15)8(18,19)20)2(24)1-3(25)5(12,13)7(16,17)9(21,22)23/h1H2 |
| InChIKey | NICYPDXBQUERJQ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| EPA Substance Registry System | 5H,5H-Perfluoro-4,6-nonanedione (113116-18-0) |
Description and Uses
5H,5H-Perfluorononane-4,6-dione is used for the synthesis of polyfluorodiketonate transition-metal complexes,1 and for preparing volatile complexes of copper, calcium, strontium, barium, and yttrium for use as chemical vapor deposition (CVD) precursors.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 1-10 |
| Hazard Note | Irritant |
| HS Code | 2914199090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
